CAS 102187-19-9: Phenylcarbamoylnaphthoquinonediethylaminomethylphenyl
Description:Phenylcarbamoylnaphthoquinonediethylaminomethylphenyl, identified by its CAS number 102187-19-9, is a complex organic compound that features a naphthoquinone core, which is known for its reactivity and potential biological activity. This compound likely exhibits characteristics typical of naphthoquinones, such as the ability to participate in redox reactions due to the presence of the quinone functional group. The presence of the phenyl and diethylamino groups suggests that it may have enhanced solubility in organic solvents and could exhibit unique electronic properties, potentially influencing its reactivity and interaction with biological systems. Additionally, the carbamoyl group may impart specific functional properties, such as the ability to form hydrogen bonds, which could affect its pharmacological profile. Overall, while specific data on its physical and chemical properties may not be readily available, the structural features indicate that it could be of interest in medicinal chemistry and materials science due to its potential reactivity and biological activity.
Formula:C28H27N3O2
InChI:InChI=1/C28H27N3O2/c1-4-31(5-2)21-15-16-25(19(3)17-21)30-26-18-24(27(32)23-14-10-9-13-22(23)26)28(33)29-20-11-7-6-8-12-20/h6-18H,4-5H2,1-3H3,(H,29,33)/b30-26+
- Synonyms:
- 2-Phenylcarbamoyl-1,4-naphthoquinone-4-(4-diethylamino-2-methylphenyl)imine
- (4E)-4-{[4-(diethylamino)-2-methylphenyl]imino}-1-oxo-N-phenyl-1,4-dihydronaphthalene-2-carboxamide

2-Phenylcarbamoyl-1,4-naphthoquinone-4-(4-diethylamino-2-methylphenyl)imine
Ref: 3B-P1149
5g | 63.00 € |

2-Naphthalenecarboxamide, 4-[[4-(diethylamino)-2-methylphenyl]imino]-1,4-dihydro-1-oxo-N-phenyl-
Ref: IN-DA0006UQ
1g | 45.00 € |

2-Phenylcarbamoyl-1,4-naphthoquinone-4-(4-diethylamino-2-methylphenyl)imine
Ref: 3D-CEA18719
5g | Discontinued | Request information |