CAS 10219-04-2
:N-(3-Fluorophenyl)-N-methylcarbamothioic chloride
Description:
N-(3-Fluorophenyl)-N-methylcarbamothioic chloride, with the CAS number 10219-04-2, is a chemical compound that belongs to the class of carbamothioic acids and their derivatives. This substance features a fluorophenyl group, which contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the thioic chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it useful in organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Its applications may include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals. As with many organofluorine compounds, it may also exhibit distinct biological activity, which could be of interest in medicinal chemistry. Proper storage conditions are essential to maintain its stability, and it should be kept away from moisture and incompatible substances.
Formula:C8H7ClFNS
InChI:InChI=1S/C8H7ClFNS/c1-11(8(9)12)7-4-2-3-6(10)5-7/h2-5H,1H3
InChI key:InChIKey=HSDZSNCIZXXUGE-UHFFFAOYSA-N
SMILES:N(C(Cl)=S)(C)C1=CC(F)=CC=C1
Synonyms:- (3-Fluorophenyl)methylcarbamothioic chloride
- 3-Fluorophenyl(methyl)carbamothioic chloride
- Carbamothioic chloride, (3-fluorophenyl)methyl-
- Carbamothioic chloride, N-(3-fluorophenyl)-N-methyl-
- Carbaniloyl chloride, m-fluoro-N-methylthio-
- N-(3-Fluorophenyl)-N-methylcarbamothioic chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
