CAS 102191-92-4
:(tert-butyldimethylsilyloxy)acetaldehyde
Description:
(tert-Butyldimethylsilyloxy)acetaldehyde is an organosilicon compound characterized by the presence of a tert-butyldimethylsilyloxy group attached to an acetaldehyde moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its stability under standard conditions. It features a silyl ether functional group, which imparts unique reactivity and solubility properties, making it useful in organic synthesis, particularly in protecting groups for alcohols and aldehydes. The tert-butyldimethylsilyloxy group enhances the compound's resistance to hydrolysis, allowing for selective reactions in synthetic pathways. Additionally, the presence of the aldehyde functional group contributes to its reactivity, enabling it to participate in various chemical transformations, such as nucleophilic additions. This compound is often utilized in the synthesis of more complex organic molecules and can be handled with standard laboratory safety precautions. As with many organosilicon compounds, it is important to consider its compatibility with other reagents and solvents in chemical reactions.
Formula:C8H18O2Si
InChI:InChI=1/C8H18O2Si/c1-8(2,3)11(4,5)10-7-6-9/h6H,7H2,1-5H3
SMILES:CC(C)(C)[Si](C)(C)OCC=O
Synonyms:- {[Tert-Butyl(Dimethyl)Silyl]Oxy}Acetaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-[(tert-Butyldimethylsilyl)oxy]acetaldehyde
CAS:Formula:C8H18O2SiPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:174.32Acetaldehyde, 2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-
CAS:Formula:C8H18O2SiPurity:90%Color and Shape:LiquidMolecular weight:174.3128Ref: IN-DA0006UO
1g26.00€5g60.00€10g88.00€25g168.00€50g213.00€100g501.00€250gTo inquire500gTo inquire250mg25.00€(tert-Butyldimethylsilyloxy)acetaldehyde
CAS:<p>(tert-Butyldimethylsilyloxy)acetaldehyde</p>Formula:C8H18O2SiPurity:90%Color and Shape: clear. colourless liquidMolecular weight:174.31282g/molt-Butyldimethylsiloxyacetaldehyde
CAS:<p>S25086 - t-Butyldimethylsiloxyacetaldehyde</p>Formula:C8H18O2SiPurity:90%Color and Shape:Liquid, ClearMolecular weight:174.315(tert-Butyldimethylsilyloxy)acetaldehyde
CAS:Controlled ProductFormula:C8H18O2SiColor and Shape:NeatMolecular weight:174.31(tert-Butyldimethylsilyloxy)acetaldehyde
CAS:<p>(tert-Butyldimethylsilyloxy) acetaldehyde is a synthesis intermediate in the asymmetric synthesis of (R)-(+)-1,2-diaminocyclohexane. It can be synthesised by the reaction of an aldehyde with tert-butyldimethylsilyl chloride and imine. The product can be hydrolyzed to give propargylamine or converted to esters using fatty acid chlorides. (tert-Butyldimethylsilyloxy) acetaldehyde is also used as an acceptor for piperazine, which can be used to form hydrochloride salts of amines and amides. In this way, it is used in the synthesis of fatty acid esters and organocatalysts.</p>Formula:C8H18O2SiPurity:Min. 95%Molecular weight:174.31 g/mol





