CymitQuimica logo

CAS 102191-92-4

:

(tert-butyldimethylsilyloxy)acetaldehyde

Description:
(tert-Butyldimethylsilyloxy)acetaldehyde is an organosilicon compound characterized by the presence of a tert-butyldimethylsilyloxy group attached to an acetaldehyde moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its stability under standard conditions. It features a silyl ether functional group, which imparts unique reactivity and solubility properties, making it useful in organic synthesis, particularly in protecting groups for alcohols and aldehydes. The tert-butyldimethylsilyloxy group enhances the compound's resistance to hydrolysis, allowing for selective reactions in synthetic pathways. Additionally, the presence of the aldehyde functional group contributes to its reactivity, enabling it to participate in various chemical transformations, such as nucleophilic additions. This compound is often utilized in the synthesis of more complex organic molecules and can be handled with standard laboratory safety precautions. As with many organosilicon compounds, it is important to consider its compatibility with other reagents and solvents in chemical reactions.
Formula:C8H18O2Si
InChI:InChI=1/C8H18O2Si/c1-8(2,3)11(4,5)10-7-6-9/h6H,7H2,1-5H3
InChI key:MEBFFOKESLAUSJ-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCC=O
Synonyms:
  • {[Tert-Butyl(Dimethyl)Silyl]Oxy}Acetaldehyde
Found 8 products.