CymitQuimica logo

CAS 1021910-21-3

:

4-(2-Methyl-5-thiazolyl)-2-butanone

Description:
4-(2-Methyl-5-thiazolyl)-2-butanone, identified by its CAS number 1021910-21-3, is an organic compound characterized by its thiazole ring and ketone functional group. This compound features a butanone backbone with a methyl-substituted thiazole moiety, which contributes to its unique chemical properties. Typically, thiazole derivatives exhibit biological activity, making this compound of interest in pharmaceutical research. The presence of the thiazole ring may enhance its ability to interact with biological targets, potentially leading to applications in drug development. In terms of physical properties, while specific values may vary, compounds of this nature often exhibit moderate solubility in organic solvents and may have distinct melting and boiling points influenced by their molecular structure. Additionally, the compound's reactivity can be attributed to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. Overall, 4-(2-Methyl-5-thiazolyl)-2-butanone represents a class of compounds with potential utility in medicinal chemistry and related fields.
Formula:C8H11NOS
InChI:InChI=1S/C8H11NOS/c1-6(10)3-4-8-5-9-7(2)11-8/h5H,3-4H2,1-2H3
InChI key:InChIKey=YHAXVCGETPYWCP-UHFFFAOYSA-N
SMILES:C(CC(C)=O)C=1SC(C)=NC1
Synonyms:
  • 2-Butanone, 4-(2-methyl-5-thiazolyl)-
  • 4-(2-Methyl-5-thiazolyl)-2-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.