CAS 1021913-03-0
:7-Chloro-6-iodo-4-quinolinol
Description:
7-Chloro-6-iodo-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. This compound features a chlorine atom at the 7-position and an iodine atom at the 6-position of the quinoline ring, contributing to its unique reactivity and potential biological activity. The presence of the hydroxyl group at the 4-position enhances its solubility in polar solvents and may influence its interaction with biological targets. 7-Chloro-6-iodo-4-quinolinol is of interest in medicinal chemistry due to its potential applications in pharmaceuticals, particularly as an antimicrobial or antiviral agent. Its halogen substituents can also affect its electronic properties, making it a candidate for further research in drug development. As with many halogenated compounds, considerations regarding its environmental impact and toxicity are essential in its handling and application.
Formula:C9H5ClINO
InChI:InChI=1S/C9H5ClINO/c10-6-4-8-5(3-7(6)11)9(13)1-2-12-8/h1-4H,(H,12,13)
InChI key:InChIKey=WOCKEJPQIBCNFE-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(Cl)C(I)=C2)N=CC1
Synonyms:- 7-Chloro-6-iodoquinolin-4-ol
- 4-Quinolinol, 7-chloro-6-iodo-
- 7-Chloro-6-iodo-4-quinolinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
