CAS 1021928-08-4

3,5-Difluoro-α-methylbenzeneethanol

Description:

3,5-Difluoro-α-methylbenzeneethanol, also known by its CAS number 1021928-08-4, is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms at the 3 and 5 positions, and a hydroxyl group (-OH) attached to a carbon that is also bonded to a methyl group. This compound exhibits properties typical of alcohols, including the ability to engage in hydrogen bonding, which can influence its solubility in polar solvents. The presence of fluorine atoms contributes to its unique reactivity and can enhance its lipophilicity, potentially affecting its biological activity and interaction with other chemical species. The molecular structure suggests that it may have applications in pharmaceuticals or materials science, particularly in the development of fluorinated compounds that can exhibit improved stability or altered biological properties. As with many fluorinated compounds, it may also exhibit distinct physical properties such as boiling and melting points, which are influenced by the electronegativity of the fluorine atoms.

Formula: C₉H₁₀F₂O

InChI: InChI=1S/C9H10F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-6,12H,2H2,1H3

InChI key: InChIKey=RBXBUNVTDIPYQN-UHFFFAOYSA-N

SMILES: C(C(C)O)C1=CC(F)=CC(F)=C1

Synonyms:

• 1-(3,5-Difluorophenyl)propan-2-ol
• 3,5-Difluoro-α-methylbenzeneethanol
• Benzeneethanol, 3,5-difluoro-α-methyl-