CAS 102195-79-9
:Boc-cis-Hyp-OMe
Description:
Boc-cis-Hyp-OMe, also known as Boc-cis-4-hydroxyproline methyl ester, is a derivative of the amino acid hydroxyproline, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and a methyl ester functionality. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to stabilize peptide bonds and influence the conformation of peptides. The cis configuration of the hydroxyproline moiety is significant, as it can affect the biological activity and structural properties of the resulting peptides. The Boc group serves as a protective group that can be removed under acidic conditions, allowing for further functionalization or coupling reactions. The methyl ester enhances solubility and can facilitate the incorporation of the amino acid into larger peptide chains. Overall, Boc-cis-Hyp-OMe is a valuable building block in the synthesis of bioactive peptides and pharmaceuticals, contributing to the development of compounds with specific therapeutic properties.
Formula:C11H19NO5
InChI:InChI=1/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8-/m0/s1
SMILES:CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)O
Synonyms:- N-Boc-cis-4-Hydroxy-L-proline methyl ester
- 1-Tert-Butyl 2-Methyl 4-Hydroxypyrrolidine-1,2-Dicarboxylate
- 1-tert-butyl 2-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate
- N-T-Boc-Cis-4-Hydroxyl-L-Proline Methyl Ester
- 1-Tert-Butyl 2-Methyl Cis-4-Hydroxypyrrolidine-1,2-Dicarboxylate
- cis-Boc-Hyp-Ome
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-(tert-Butoxycarbonyl)-cis-4-hydroxy-L-proline Methyl Ester
CAS:Formula:C11H19NO5Purity:>97.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:245.281,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S,4S)-
CAS:Formula:C11H19NO5Purity:97%Color and Shape:SolidMolecular weight:245.2723N-Boc-4-hydroxy-L-proline methyl ester
CAS:N-Boc-cis-4-hydroxy-L-proline methyl ester serves as a non-cleavable linker in antibody-drug conjugate (ADC) synthesis and functions as an alkyl chain-basedFormula:C11H19NO5Purity:≥98%Color and Shape:SolidMolecular weight:245.27N-t-BOC-cis-4-Hydroxy-L-Proline Methyl Ester
CAS:N-t-BOC-cis-4-Hydroxy-L-Proline Methyl EsterFormula:C11H19NO5Purity:97%Color and Shape: white solidMolecular weight:245.27g/molBoc-cis-hydroxyproline methyl ester
CAS:Formula:C11H19NO5Purity:95%Color and Shape:SolidMolecular weight:245.275N-Boc-cis-4-hydroxy-L-proline methyl ester
CAS:N-Boc-cis-4-hydroxy-L-proline methyl ester is a synthetic molecule that can be used to synthesize amides. It is typically prepared through a multistep process that begins with the condensation of an acid chloride and an amine. The reaction product is then treated with methyl chloroformate to produce the desired compound, which can be purified by recrystallization. N-Boc-cis-4-hydroxy-L-proline methyl ester has been used in the synthesis of nucleophilic and reactive molecules, as well as industrial processes.Formula:C11H19NO5Purity:Min. 95%Color and Shape:White PowderMolecular weight:245.27 g/mol






