CAS 10220-66-3

3-Mercapto-N-phenylpropanamide

Description:

3-Mercapto-N-phenylpropanamide, with the CAS number 10220-66-3, is an organic compound characterized by the presence of a thiol (-SH) group and an amide functional group. This compound features a phenyl group attached to a propanamide backbone, which contributes to its unique chemical properties. The thiol group imparts reactivity, allowing for potential applications in various chemical reactions, including nucleophilic substitutions and the formation of disulfide bonds. The presence of the phenyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, 3-Mercapto-N-phenylpropanamide may exhibit biological activity, making it of interest in medicinal chemistry and biochemistry. Its structural features suggest potential uses in the synthesis of other compounds, as well as in materials science, where thiol groups can participate in cross-linking reactions. Overall, this compound's distinctive functional groups and structural characteristics make it a valuable subject of study in both synthetic and applied chemistry contexts.

Formula: C₉H₁₁NOS

InChI: InChI=1S/C9H11NOS/c11-9(6-7-12)10-8-4-2-1-3-5-8/h1-5,12H,6-7H2,(H,10,11)

InChI key: InChIKey=YSPHRFZMBKXSAX-UHFFFAOYSA-N

SMILES: N(C(CCS)=O)C1=CC=CC=C1

Synonyms:

• N-Phenyl-β-mercaptopropionamide
• Propanamide, 3-mercapto-N-phenyl-
• 3-Mercaptopropionanilide
• Propionanilide, 3-mercapto-
• 3-Mercapto-N-phenylpropanamide