CymitQuimica logo

CAS 102201-72-9

:

4-Chloro-α-(4-chlorophenyl)-α-[[(1-methylethyl)amino]methyl]benzenemethanol

Description:
4-Chloro-α-(4-chlorophenyl)-α-[[(1-methylethyl)amino]methyl]benzenemethanol, with CAS number 102201-72-9, is a chemical compound that belongs to the class of organic compounds known as phenols and amines. This substance features a complex structure characterized by the presence of multiple aromatic rings, chlorinated groups, and an isopropylamine moiety. The chlorinated phenyl groups contribute to its potential biological activity, while the hydroxyl group indicates its classification as a phenolic compound. The presence of the isopropylamine group suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Its solubility and reactivity can be influenced by the functional groups present, which may affect its pharmacokinetic properties. Additionally, the compound may exhibit specific stereochemistry due to the presence of chiral centers, which can impact its biological activity and interactions. Overall, this compound's unique structural features may render it significant in various chemical and pharmaceutical applications.
Formula:C17H19Cl2NO
InChI:InChI=1S/C17H19Cl2NO/c1-12(2)20-11-17(21,13-3-7-15(18)8-4-13)14-5-9-16(19)10-6-14/h3-10,12,20-21H,11H2,1-2H3
InChI key:InChIKey=LWPLXYPCRZFALK-UHFFFAOYSA-N
SMILES:C(CNC(C)C)(O)(C1=CC=C(Cl)C=C1)C2=CC=C(Cl)C=C2
Synonyms:
  • 4-Chloro-α-(4-chlorophenyl)-α-[[(1-methylethyl)amino]methyl]benzenemethanol
  • 1,1-Bis(4-chlorophenyl)-2-(isopropylamino)ethanol
  • Benzenemethanol, 4-chloro-α-(4-chlorophenyl)-α-[[(1-methylethyl)amino]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.