CAS 102207-59-0

1-(3-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole hydrochloride

Description:

1-(3-Nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a pyridoindole framework. This compound features a nitrophenyl group, contributing to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical research. The presence of the nitro group may impart specific electronic properties, influencing its interaction with biological targets. This compound is of interest in medicinal chemistry, potentially serving as a lead compound for the development of new therapeutic agents. Its molecular structure suggests possible interactions with neurotransmitter systems, making it a candidate for further investigation in neuropharmacology. Safety and handling precautions should be observed due to the presence of the nitro group, which can be associated with toxicity and environmental concerns. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in drug design.

Formula: C₁₇H₁₆ClN₃O₂

InChI: InChI=1/C17H15N3O2.ClH/c21-20(22)12-5-3-4-11(10-12)16-17-14(8-9-18-16)13-6-1-2-7-15(13)19-17;/h1-7,10,16,18-19H,8-9H2;1H

SMILES: c1ccc2c(c1)c1CCNC(c3cccc(c3)N(=O)=O)c1[nH]2.Cl

1-(3-Nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole hydrochloride

CAS: 102207-59-0

1-(3-Nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole hydrochloride

Purity: 95%

Molecular weight: 329.79g/mol

Ref: 54-OR1064492