CAS 1022094-45-6

4-(2,2-Difluoroethenyl)-1,1′-biphenyl

Description:

4-(2,2-Difluoroethenyl)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a 2,2-difluoroethenyl group introduces notable fluorine substituents, which can significantly influence the compound's chemical properties, such as reactivity and polarity. This compound is likely to exhibit unique electronic characteristics due to the electron-withdrawing nature of the fluorine atoms, potentially affecting its behavior in various chemical reactions and applications. Additionally, the presence of the difluoroethenyl group may impart specific physical properties, such as altered melting and boiling points compared to similar compounds without fluorine substituents. The compound may find applications in materials science, particularly in the development of organic electronics or as a precursor in synthetic chemistry. However, detailed studies on its stability, solubility, and reactivity would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₄H₁₀F₂

InChI: InChI=1S/C14H10F2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10H

InChI key: InChIKey=VOXKSAHNCGAIFN-UHFFFAOYSA-N

SMILES: C(=C(F)F)C1=CC=C(C=C1)C2=CC=CC=C2

Synonyms:

• 1,1′-Biphenyl, 4-(2,2-difluoroethenyl)-
• 4-(2,2-Difluorovinyl)-1,1′-biphenyl
• 4-(2,2-Difluoroethenyl)biphenyl
• 1,1-Difluoro-2-(4-phenylphenyl)ethene
• 4-(2,2-Difluoroethenyl)-1,1′-biphenyl