CAS 102210-03-7

3,3,3-Trifluoro-2-methyl-D-alanine

Description:

3,3,3-Trifluoro-2-methyl-D-alanine is an amino acid derivative characterized by the presence of three fluorine atoms attached to the carbon chain, specifically at the 3-position, along with a methyl group at the 2-position. This compound is notable for its unique fluorinated structure, which can influence its biochemical properties and interactions. The trifluoromethyl group enhances lipophilicity and can affect the compound's stability and reactivity, making it of interest in medicinal chemistry and drug design. As a D-amino acid, it may exhibit different biological activities compared to its L-counterpart, potentially impacting protein synthesis and function. The presence of fluorine atoms can also impart distinctive spectroscopic properties, useful in analytical chemistry. Additionally, 3,3,3-Trifluoro-2-methyl-D-alanine may have applications in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis, owing to its unique structural features and potential for modulating biological activity.

Formula: C₄H₆F₃NO₂

InChI: InChI=1S/C4H6F3NO2/c1-3(8,2(9)10)4(5,6)7/h8H2,1H3,(H,9,10)/t3-/m0/s1

InChI key: InChIKey=JBQBFDPQDFDHEC-VKHMYHEASA-N

SMILES: [C@@](C(F)(F)F)(C(O)=O)(C)N

Synonyms:

• D-Alanine, 3,3,3-trifluoro-2-methyl-
• 3,3,3-Trifluoro-2-methyl-D-alanine
• 2-Amino-3,3,3-trifluoro-2-methylpropanoic acid

3,3,3-Trifluoro-2-methyl-D-Alanine

Controlled Product

CAS: 102210-03-7

Formula: C₄H₆F₃NO₂

Color and Shape: Neat

Molecular weight: 157.091

Ref: TR-T643280