CAS 1022150-12-4: 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine
Description:3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine, with the CAS number 1022150-12-4, is a synthetic organic compound that belongs to the class of pyrazolopyrimidines. This compound features a pyrazolo[3,4-d]pyrimidine core, which is characterized by a fused bicyclic structure that includes both pyrazole and pyrimidine rings. The presence of a phenoxyphenyl group and a piperidyl substituent contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as enzyme inhibition or receptor modulation, which are common in drug candidates. Its molecular structure suggests potential interactions with various biological targets, possibly influencing pathways related to cell signaling or metabolic processes. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups, which are critical for its pharmacokinetic and pharmacodynamic profiles. Further studies would be necessary to elucidate its specific biological effects and therapeutic potential.
InChI:InChI=1S/C22H22N6O/c23-21-19-20(15-8-10-18(11-9-15)29-17-6-2-1-3-7-17)27-28(22(19)26-14-25-21)16-5-4-12-24-13-16/h1-3,6-11,14,16,24H,4-5,12-13H2,(H2,23,25,26)
- Synonyms:
- 3-(4-Phenoxy-phenyl)-1-piperidin-3-yl-1H-pyrazolo[3,4-d]pyrimidin-4-ylamine
- (R)-3-(4-phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyriMidin-4-aMine