CymitQuimica logo

CAS 1022158-36-6

:

1-(Tetrahydro-2H-pyran-2-yl)-1H-indazole-4-carboxaldehyde

Description:
1-(Tetrahydro-2H-pyran-2-yl)-1H-indazole-4-carboxaldehyde is a chemical compound characterized by its unique structural features, which include an indazole core fused with a tetrahydro-2H-pyran moiety and an aldehyde functional group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions, including condensation and oxidation. The tetrahydro-2H-pyran ring contributes to the compound's overall stability and may influence its solubility and polarity. Additionally, the indazole structure is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its synthesis, reactivity, and biological evaluation. Overall, this compound represents a fascinating intersection of organic chemistry and potential pharmacological applications.
Formula:C13H14N2O2
InChI:InChI=1S/C13H14N2O2/c16-9-10-4-3-5-12-11(10)8-14-15(12)13-6-1-2-7-17-13/h3-5,8-9,13H,1-2,6-7H2
InChI key:InChIKey=WHYXQPGHZDUOAZ-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(N(N=C2)C3CCCCO3)=CC=C1
Synonyms:
  • 1-(Tetrahydro-2H-pyran-2-yl)-1H-indazole-4-carboxaldehyde
  • 1H-Indazole-4-carboxaldehyde, 1-(tetrahydro-2H-pyran-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.