CAS 102225-55-8
:(4-ETHYLPHENYL)-(4'-N-PROPYLPHENYL)ETHYNE
Description:
(4-Ethylphenyl)-(4'-n-propylphenyl)ethyne, identified by its CAS number 102225-55-8, is an organic compound characterized by its unique structure, which features an ethyne (alkyne) linkage between two substituted phenyl groups. The presence of ethyl and n-propyl groups on the para positions of the phenyl rings contributes to its hydrophobic nature and influences its solubility in organic solvents. This compound is likely to exhibit interesting optical and electronic properties due to the conjugated system formed by the ethyne linkage and the aromatic rings. Additionally, it may participate in various chemical reactions typical of alkynes, such as addition reactions. Its potential applications could span fields like materials science, organic electronics, or as intermediates in organic synthesis. However, specific data regarding its physical properties, such as melting point, boiling point, and reactivity, would require further investigation or experimental determination.
Formula:C19H20
InChI:InChI=1/C19H20/c1-3-5-17-10-12-19(13-11-17)15-14-18-8-6-16(4-2)7-9-18/h6-13H,3-5H2,1-2H3
SMILES:CCCc1ccc(cc1)C#Cc1ccc(CC)cc1
Synonyms:- 1-Ethyl-4-[2-(4-N-Propylphenyl)Ethynyl]Benzene
- 2T3
- 4-Ethylphenyl-4'-N-Propylphenylacetylene
- 4-Ethyl-4'-N-Propyltolane
- Tolane 2-3
- 1-[(4-Ethylphenyl)ethynyl]-4-propylbenzene
- 1-Ethyl-4-[(4-n-propylphenyl)ethynyl]benzene, 99+%
- 1-Ethyl-4-[(4-Propylphenyl)Ethynyl]Benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
