CymitQuimica logo

CAS 10223-91-3

:

4-[3,5-dioxo-4-(phenylcarbamoyl)cyclohexyl]phenyl phenylcarbamate

Description:
4-[3,5-Dioxo-4-(phenylcarbamoyl)cyclohexyl]phenyl phenylcarbamate, with the CAS number 10223-91-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a cyclohexane ring substituted with phenyl and carbamoyl groups, as well as dioxo functionalities. The presence of multiple functional groups suggests that it may exhibit diverse chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound's molecular structure indicates potential for hydrogen bonding and interactions with biological targets, which could influence its solubility and bioactivity. Additionally, the phenyl groups may contribute to its stability and lipophilicity. As with many carbamate derivatives, it may possess insecticidal or herbicidal properties, making it of interest in agricultural chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling considerations should also be taken into account due to the potential toxicity associated with carbamate compounds.
Formula:C26H22N2O5
InChI:InChI=1/C26H22N2O5/c29-22-15-18(16-23(30)24(22)25(31)27-19-7-3-1-4-8-19)17-11-13-21(14-12-17)33-26(32)28-20-9-5-2-6-10-20/h1-14,18,24H,15-16H2,(H,27,31)(H,28,32)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.