CAS 10224-18-7

Bisisocyanotophenylhexafluoropropane; 96%

Description:

Bisisocyanotophenylhexafluoropropane, with the CAS number 10224-18-7, is a chemical compound characterized by its unique structure, which includes two isocyanate functional groups attached to a phenyl ring, along with a hexafluoropropane moiety. This compound is typically used in specialized applications, including polymer synthesis and as a reactive intermediate in organic chemistry. Its high fluorine content imparts notable properties such as increased thermal stability and chemical resistance, making it suitable for use in harsh environments. The presence of isocyanate groups suggests that it can participate in various chemical reactions, including polymerization and cross-linking, which are essential in the production of advanced materials. Additionally, due to its potential reactivity, handling precautions are necessary to avoid exposure, as isocyanates can be hazardous. Overall, Bisisocyanotophenylhexafluoropropane is a specialized compound with applications in materials science and organic synthesis, characterized by its unique functional groups and fluorinated structure.

Formula: C₈H₅BrF₂O

InChI: InChI=1/C8H5BrF2O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2

SMILES: c1cc(c(cc1F)F)C(=O)CBr

Synonyms:

• 2,2-Bis(isocyanotophenyl)hexafluoropropane
• 2,2-Bis(4-isocyanatophenyl)hexafluoro
• 2-Bromo-1-(2,4-Difluorophenyl)Ethanone

Benzene, 1,1'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[4-isocyanato-

CAS: 10224-18-7

Formula: C₁₇H₈F₆N₂O₂

Purity: 98%

Molecular weight: 386.2480

Ref: IN-DA00070D

2,2-Bis(4-isocyanatophenyl)hexafluoropropane

CAS: 10224-18-7

Formula: C₁₇H₈F₆N₂O₂

Purity: >98.0%(GC)

Color and Shape: White - Yellow Liquid

Molecular weight: 386.25

Ref: 3B-B1509

2,2-Bis(4-isocyanatophenyl)hexafluoropropane

CAS: 10224-18-7

2,2-Bis(4-isocyanatophenyl)hexafluoropropane

Purity: 98%

Molecular weight: 386.25g/mol

Ref: 54-PC3481