CAS 102246-82-2
:N-[2-(4-METHOXYPHENOXY)ETHYL]-N-METHYLAMINE
Description:
N-[2-(4-Methoxyphenoxy)ethyl]-N-methylamine, with the CAS number 102246-82-2, is an organic compound characterized by its amine functional group and ether linkage. This substance features a methoxy group attached to a phenyl ring, which contributes to its hydrophobic properties, while the ethyl chain connects the phenoxy group to the N-methylamine moiety. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. As a tertiary amine, it can participate in various chemical reactions, including nucleophilic substitutions and complexation with acids. The compound's structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific biological activities or toxicity profiles would require further investigation. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, N-[2-(4-Methoxyphenoxy)ethyl]-N-methylamine represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C10H16NO2
InChI:InChI=1/C10H15NO2/c1-11-7-8-13-10-5-3-9(12-2)4-6-10/h3-6,11H,7-8H2,1-2H3/p+1
Synonyms:- 2-(4-methoxyphenoxy)-N-methylethanaminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
