CAS 102249-49-0

6-Bromo-3-phenyl-2-pyridinamine

Description:

6-Bromo-3-phenyl-2-pyridinamine is an organic compound characterized by its bromine substitution and the presence of a pyridine ring. This compound features a bromine atom at the 6-position and a phenyl group at the 3-position of the pyridinamine structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amino group (-NH2) in the pyridine ring suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other chemical entities. Additionally, its bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₉BrN₂

InChI: InChI=1S/C11H9BrN2/c12-10-7-6-9(11(13)14-10)8-4-2-1-3-5-8/h1-7H,(H2,13,14)

InChI key: InChIKey=RVOFHMPUODSEII-UHFFFAOYSA-N

SMILES: NC1=C(C2=CC=CC=C2)C=CC(Br)=N1

Synonyms:

• 2-Pyridinamine, 6-bromo-3-phenyl-
• 6-Bromo-3-phenyl-2-pyridinamine
• 2-Amino-6-bromo-3-phenylpyridine