CAS 10225-01-1

Carbamodithioic acid, dimethyl-, 1,4-butanediyl ester

Description:

Carbamodithioic acid, dimethyl-, 1,4-butanediyl ester, with the CAS number 10225-01-1, is an organic compound characterized by its functional groups, which include a carbamodithioic acid moiety and a butanediyl ester linkage. This compound typically exhibits properties associated with both thiol and ester functionalities, leading to potential reactivity in various chemical environments. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of sulfur in its structure suggests that it may have applications in agriculture as a pesticide or herbicide, as well as in the synthesis of other organic compounds. Additionally, the dimethyl groups contribute to its steric properties, influencing its solubility and reactivity. Safety data should be consulted for handling and storage, as compounds with sulfur and nitrogen functionalities can exhibit toxicity or environmental hazards. Overall, this compound's unique structure positions it as a versatile intermediate in organic synthesis and potential applications in agrochemicals.

Formula: C₁₀H₂₀N₂S₄

InChI: InChI=1S/C10H20N2S4/c1-11(2)9(13)15-7-5-6-8-16-10(14)12(3)4/h5-8H2,1-4H3

InChI key: InChIKey=NLILEBBDWYPPKA-UHFFFAOYSA-N

SMILES: S(C(N(C)C)=S)CCCCSC(N(C)C)=S

Synonyms:

• Carbamodithioic acid, dimethyl-, 1,4-butanediyl ester
• 1,4-Butanediyl bis(dimethyldithiocarbamate)

Carbamodithioic acid, dimethyl-, 1,4-butanediyl ester (9CI)

CAS: 10225-01-1

Formula: C₁₀H₂₀N₂S₄

Molecular weight: 296.5392

Ref: IN-DA000715