CAS 10225-48-6

1,2,3,4-tetra-O-acetyl-6-bromo-6-deoxyhexopyranose

Description:

1,2,3,4-Tetra-O-acetyl-6-bromo-6-deoxyhexopyranose is a synthetic carbohydrate derivative characterized by the presence of four acetyl groups and a bromine atom attached to a hexopyranose structure. This compound is typically derived from a hexose sugar, where the hydroxyl groups at positions 1, 2, 3, and 4 are acetylated, enhancing its stability and solubility in organic solvents. The bromine substitution at the 6-position indicates that it is a deoxy sugar, which can influence its reactivity and biological activity. The acetyl groups can be removed through hydrolysis or enzymatic processes, allowing for the regeneration of the original sugar structure. This compound is often utilized in organic synthesis and carbohydrate chemistry, serving as an intermediate in the preparation of more complex glycosides or as a building block for various biochemical applications. Its unique structure makes it a valuable tool in the study of carbohydrate interactions and modifications.

Formula: C₁₄H₁₉BrO₉

InChI: InChI=1/C14H19BrO9/c1-6(16)20-11-10(5-15)24-14(23-9(4)19)13(22-8(3)18)12(11)21-7(2)17/h10-14H,5H2,1-4H3

SMILES: CC(=O)OC1C(CBr)OC(C(C1OC(=O)C)OC(=O)C)OC(=O)C

Synonyms:

• 1,2,3,4-Tetra-O-acetyl-6-bromo-6-deoxyhexopyranose