CAS 102250-99-7
:Dibenzofuran, homopolymer
Description:
Dibenzofuran, homopolymer, identified by CAS number 102250-99-7, is a synthetic polymer derived from dibenzofuran, a heterocyclic compound featuring a fused dibenzofuran structure. This polymer exhibits characteristics typical of aromatic compounds, including high thermal stability and resistance to degradation under elevated temperatures. Its structure contributes to its rigidity and potential for high mechanical strength, making it suitable for various applications in materials science. The polymer is generally insoluble in common solvents, which enhances its utility in environments where chemical resistance is crucial. Additionally, dibenzofuran, homopolymer may possess unique optical properties due to its conjugated system, which can be advantageous in applications such as organic electronics or photonics. However, specific properties such as molecular weight, density, and processing conditions can vary based on the synthesis method and additives used. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, dibenzofuran, homopolymer represents a versatile material with potential applications in advanced polymer technologies.
Formula:(C12H8O)x
InChI:InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H
InChI key:InChIKey=TXCDCPKCNAJMEE-UHFFFAOYSA-N
SMILES:C1=2C=3C(OC1=CC=CC2)=CC=CC3
Synonyms:- Polydibenzofuran
- Dibenzofuran, homopolymer
- Dibenzofuran polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
