CAS 10226-37-6
:2-(5-methoxy-1H-indazol-3-yl)acetic acid
Description:
2-(5-methoxy-1H-indazol-3-yl)acetic acid, with the CAS number 10226-37-6, is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features a methoxy group (-OCH3) at the 5-position of the indazole ring, contributing to its unique properties and reactivity. The presence of the acetic acid functional group (-COOH) indicates that it can act as a weak acid, capable of donating protons in solution. This compound may exhibit biological activity, potentially influencing various biochemical pathways, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the methoxy group can enhance lipophilicity, affecting the compound's absorption and distribution in biological systems. Overall, 2-(5-methoxy-1H-indazol-3-yl)acetic acid is a compound of interest in medicinal chemistry, with potential applications in drug development and therapeutic research.
Formula:C10H10N2O3
InChI:InChI=1/C10H10N2O3/c1-15-6-2-3-8-7(4-6)9(12-11-8)5-10(13)14/h2-4H,5H2,1H3,(H,11,12)(H,13,14)
SMILES:COc1ccc2c(c1)c(CC(=O)O)n[nH]2
Synonyms:- (5-Methoxy-1H-indazol-3-yl)acetic acid
- 1H-indazole-3-acetic acid, 5-methoxy-
- 5-Methoxyindazole-3-Aceticacid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(5-Methoxy-1H-indazol-3-yl)acetic acid
CAS:Formula:C10H10N2O3Color and Shape:SolidMolecular weight:206.1980
