CymitQuimica logo

CAS 102268-15-5

:

5-Ethyl-2,3-pyridinedicarboxylic acid

Description:
5-Ethyl-2,3-pyridinedicarboxylic acid, with the CAS number 102268-15-5, is a heterocyclic organic compound featuring a pyridine ring substituted with ethyl and carboxylic acid groups. This compound typically exhibits characteristics common to pyridine derivatives, such as being polar and capable of forming hydrogen bonds due to the presence of carboxylic acid functional groups. The ethyl substituent can influence its solubility and reactivity, potentially enhancing lipophilicity compared to other pyridine derivatives. The presence of two carboxylic acid groups suggests that it can act as a diprotic acid, capable of donating protons in solution, which may affect its behavior in various chemical reactions and biological systems. Additionally, the compound may exhibit interesting properties such as chelation with metal ions, making it relevant in coordination chemistry and potential applications in pharmaceuticals or agrochemicals. Its specific reactivity and interactions would depend on the surrounding environment, including pH and the presence of other chemical species.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c1-2-5-3-6(8(11)12)7(9(13)14)10-4-5/h3-4H,2H2,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=MTAVBTGOXNGCJR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)N=CC(CC)=C1
Synonyms:
  • 2,3-Pyridinedicarboxylic acid, 5-ethyl-
  • 5-Ethyl-2,3-Pyridinedicarboxylic Acid
  • 5-Ethylquinolinic acid
  • Imazethapyr intermediate
Found 5 products.