CAS 10228-90-7
:9-methoxyacridine
Description:
9-Methoxyacridine is an organic compound characterized by its acridine backbone, which is a polycyclic aromatic structure. It features a methoxy group (-OCH₃) attached to the ninth position of the acridine ring system, influencing its chemical properties and reactivity. This compound is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents. 9-Methoxyacridine is known for its potential applications in the fields of medicinal chemistry and photochemistry, particularly due to its fluorescent properties and ability to intercalate with nucleic acids. Its structure allows for interactions with biological molecules, making it of interest in studies related to DNA binding and potential anticancer activity. Additionally, the presence of the methoxy group can affect the compound's electronic properties, enhancing its stability and reactivity under certain conditions. As with many acridine derivatives, safety precautions should be taken when handling this substance, as it may pose health risks upon exposure.
Formula:C14H11NO
InChI:InChI=1/C14H11NO/c1-16-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H3
SMILES:COc1c2ccccc2nc2ccccc12
Synonyms:- Nsc 221435
- Acridine, 9-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
