
CAS 102285-67-6
:6-Hydroxy-2-methyl-2-[4-(phenylthio)phenyl]-2H-pyran-3(6H)-one
Description:
6-Hydroxy-2-methyl-2-[4-(phenylthio)phenyl]-2H-pyran-3(6H)-one, with the CAS number 102285-67-6, is a synthetic organic compound characterized by its pyranone structure, which features a hydroxyl group and a methyl group at specific positions on the pyran ring. The presence of a phenylthio group contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the functional groups present. Additionally, the compound's stability and behavior in different solvents can vary, which is crucial for applications in drug formulation and development. Overall, 6-Hydroxy-2-methyl-2-[4-(phenylthio)phenyl]-2H-pyran-3(6H)-one represents a complex molecule with potential utility in medicinal chemistry and related fields.
Formula:C18H16O3S
InChI:InChI=1S/C18H16O3S/c1-18(16(19)11-12-17(20)21-18)13-7-9-15(10-8-13)22-14-5-3-2-4-6-14/h2-12,17,20H,1H3
InChI key:InChIKey=BDFXTPRIYYOAQN-UHFFFAOYSA-N
SMILES:CC1(C(=O)C=CC(O)O1)C2=CC=C(SC3=CC=CC=C3)C=C2
Synonyms:- 2H-Pyran-3(6H)-one, 6-hydroxy-2-methyl-2-[4-(phenylthio)phenyl]-
- 6-Hydroxy-2-methyl-2-[4-(phenylthio)phenyl]-2H-pyran-3(6H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Pyran-3(6H)-one, 6-hydroxy-2-methyl-2-[4-(phenylthio)phenyl]-
CAS:Formula:C18H16O3SMolecular weight:312.3828
