CAS 1022919-09-0

1-[(2-Chlorophenyl)methyl]-3-oxo-2-piperazineacetic acid

Description:

1-[(2-Chlorophenyl)methyl]-3-oxo-2-piperazineacetic acid, identified by its CAS number 1022919-09-0, is a chemical compound that features a piperazine ring, which is a six-membered cyclic amine. This compound is characterized by the presence of a chlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the keto group (3-oxo) and the carboxylic acid functionality (acetic acid) suggests that it may exhibit acidic properties and could participate in various chemical reactions, such as esterification or amidation. The structural features indicate that it may interact with biological targets, making it of interest in medicinal chemistry. Its molecular structure implies potential applications in pharmaceuticals, particularly in the development of compounds with therapeutic effects. However, specific physical properties such as solubility, melting point, and stability would require empirical data for comprehensive characterization. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₅ClN₂O₃

InChI: InChI=1S/C13H15ClN2O3/c14-10-4-2-1-3-9(10)8-16-6-5-15-13(19)11(16)7-12(17)18/h1-4,11H,5-8H2,(H,15,19)(H,17,18)

InChI key: InChIKey=SPWNROYGRVIXKP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1N(CC2=C(Cl)C=CC=C2)CCNC1=O

Synonyms:

• 1-[(2-Chlorophenyl)methyl]-3-oxo-2-piperazineacetic acid
• 2-Piperazineacetic acid, 1-[(2-chlorophenyl)methyl]-3-oxo-