CAS 102293-39-0
:NBP 583
Description:
NBP 583, with the CAS number 102293-39-0, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. It is characterized as a selective inhibitor of certain biological pathways, which may contribute to its potential therapeutic applications. The compound typically exhibits a specific molecular structure that influences its solubility, stability, and reactivity. NBP 583 is often studied for its interactions with biological targets, which can include enzymes or receptors, making it relevant in the context of drug development. Additionally, its safety profile, including toxicity and pharmacokinetics, is crucial for evaluating its suitability for clinical use. As with many compounds, the characteristics of NBP 583 can vary based on its formulation and the conditions under which it is studied, including pH, temperature, and the presence of other substances. Overall, NBP 583 represents a significant area of research within the realm of chemical substances with potential therapeutic benefits.
Formula:C20H34ClN3O4
InChI:InChI=1/C20H33N3O4.ClH/c1-7-23(8-2)19(26)22-15-9-10-18(17(11-15)14(3)24)27-13-16(25)12-21-20(4,5)6;/h9-11,16,21,25H,7-8,12-13H2,1-6H3,(H,22,26);1H/t16-;/m0./s1
SMILES:CCN(CC)C(=Nc1ccc(c(c1)C(=O)C)OC[C@H](CNC(C)(C)C)O)O.Cl
Synonyms:- Urea, N-[3-acetyl-4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]-N,N-diethyl-, monohydrochloride, (S)-
- 3-[3-acetyl-4-[(2S)-3-(tert-butylamino)-2-hydroxy-propoxy]phenyl]-1,1-diethyl-urea hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Urea, N'-[3-acetyl-4-[(2S)-3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]-N,N-diethyl-, hydrochloride (1:1)
CAS:Formula:C20H34ClN3O4Color and Shape:SolidMolecular weight:415.9547

