
CAS 102293-45-8
:1-[4-[(6-Bromohexyl)oxy]butyl]-4-nitrobenzene
Description:
1-[4-[(6-Bromohexyl)oxy]butyl]-4-nitrobenzene, with the CAS number 102293-45-8, is an organic compound characterized by its complex structure, which includes a nitro group and a bromoalkyl chain. This compound features a nitro group (-NO2) attached to a benzene ring, which contributes to its potential reactivity and polarity. The presence of the bromohexyl group indicates that it has a long hydrophobic carbon chain, which can influence its solubility and interaction with biological membranes. The ether linkage formed by the butyl and bromohexyl groups suggests that it may exhibit surfactant properties, potentially allowing it to interact with both polar and nonpolar environments. Additionally, the bromine atom may impart unique reactivity, making it a candidate for various chemical transformations. Overall, this compound's characteristics suggest potential applications in fields such as materials science, pharmaceuticals, or as a chemical intermediate, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C16H24BrNO3
InChI:InChI=1S/C16H24BrNO3/c17-12-4-1-2-5-13-21-14-6-3-7-15-8-10-16(11-9-15)18(19)20/h8-11H,1-7,12-14H2
InChI key:InChIKey=OKZVAKPAIXVGKV-UHFFFAOYSA-N
SMILES:C(CCCOCCCCCCBr)C1=CC=C(N(=O)=O)C=C1
Synonyms:- Benzene, 1-[4-[(6-bromohexyl)oxy]butyl]-4-nitro-
- 1-[4-[(6-Bromohexyl)oxy]butyl]-4-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
