
CAS 1022931-50-5
:Dihydro-4-(2,2,2-trifluoroacetyl)-2H-pyran-3(4H)-one
Description:
Dihydro-4-(2,2,2-trifluoroacetyl)-2H-pyran-3(4H)-one is a chemical compound characterized by its unique structure, which includes a pyran ring and a trifluoroacetyl group. This compound typically exhibits properties associated with both heterocycles and fluorinated compounds, such as increased lipophilicity and potential biological activity. The presence of the trifluoroacetyl moiety can enhance its reactivity and influence its interactions with biological targets, making it of interest in medicinal chemistry. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, due to the presence of fluorine atoms, it may exhibit distinct chemical stability and solubility properties compared to non-fluorinated analogs. Overall, Dihydro-4-(2,2,2-trifluoroacetyl)-2H-pyran-3(4H)-one represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H7F3O3
InChI:InChI=1S/C7H7F3O3/c8-7(9,10)6(12)4-1-2-13-3-5(4)11/h4H,1-3H2
InChI key:InChIKey=LYPQKZNYVMXBLP-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1C(=O)COCC1
Synonyms:- 4-(Trifluoroacetyl)dihydro-2H-pyran-3(4H)-one
- Dihydro-4-(2,2,2-trifluoroacetyl)-2H-pyran-3(4H)-one
- 2H-Pyran-3(4H)-one, dihydro-4-(2,2,2-trifluoroacetyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.