CAS 102294-97-3

1-(4-IODOBENZYL)-4-METHYLPIPERAZINE

Description:

1-(4-Iodobenzyl)-4-methylpiperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-iodobenzyl group at one position of the piperazine ring introduces significant hydrophobic characteristics due to the iodine atom and the aromatic benzyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, influenced by the bulky iodinated aromatic group. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the reactivity of the iodine atom. Additionally, the methyl group on the piperazine ring can affect the compound's steric and electronic properties, potentially influencing its biological activity. This compound is of interest in medicinal chemistry and pharmacology, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing halogens.

Formula: C₁₂H₁₇IN₂

InChI: InChI=1/C12H17IN2/c1-14-6-8-15(9-7-14)10-11-2-4-12(13)5-3-11/h2-5H,6-10H2,1H3

SMILES: CN1CCN(CC1)Cc1ccc(cc1)I

Piperazine,1-[(4-iodophenyl)methyl]-4-methyl-

CAS: 102294-97-3

Formula: C₁₂H₁₇IN₂

Molecular weight: 316.1812

Ref: IN-DA000754

1-(4-Iodobenzyl)-4-methylpiperazine

Controlled Product

CAS: 102294-97-3

1-(4-Iodobenzyl)-4-methylpiperazine is a chemical compound that is used as a building block for the synthesis of other organic compounds. It is also a reagent for organic synthesis and can be used to prepare high-quality research chemicals. 1-(4-Iodobenzyl)-4-methylpiperazine has many applications, including use as a versatile building block and a reaction component in the preparation of complex compounds. This chemical compound has CAS No. 102294-97-3 and can be found under the name "1-(4-iodobenzyl)piperazine".

Formula: C₁₂H₁₇IN₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 316.18 g/mol

Ref: 3D-FI67304