CAS 102296-44-6
:1-(2,3-Dihydro-1,1-dimethyl-1H-inden-5-yl)ethanone
Description:
1-(2,3-Dihydro-1,1-dimethyl-1H-inden-5-yl)ethanone, with the CAS number 102296-44-6, is an organic compound characterized by its unique structure, which includes a ketone functional group and a bicyclic indene derivative. This compound features a dihydroindene moiety, contributing to its potential reactivity and stability. The presence of the ethanone group indicates that it has a carbonyl functional group, which can participate in various chemical reactions, such as nucleophilic addition. The dimethyl substitution on the indene ring enhances its steric properties and may influence its interactions with other molecules. This compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. Its applications may span across fields such as organic synthesis, pharmaceuticals, or materials science, although specific uses would depend on further research into its properties and behavior in different chemical environments. Overall, the compound's structural features suggest interesting potential for further exploration in chemical applications.
Formula:C13H16O
InChI:InChI=1S/C13H16O/c1-9(14)10-4-5-12-11(8-10)6-7-13(12,2)3/h4-5,8H,6-7H2,1-3H3
InChI key:InChIKey=HVENCELDSVORNF-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=CC(C(C)=O)=CC2)CC1
Synonyms:- 1-(1,1-Dimethyl-2,3-dihydro-1H-inden-5-yl)ethanone
- 1-(2,3-Dihydro-1,1-dimethyl-1H-inden-5-yl)ethanone
- Ethanone, 1-(2,3-dihydro-1,1-dimethyl-1H-inden-5-yl)-
- Ketone, 1,1-dimethyl-5-indanyl methyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
