CAS 1022961-49-4

3-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid

Description:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid is a complex organic compound characterized by its bicyclic structure, which includes a bicyclo[2.2.1]heptene framework. This compound features a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of the dimethylethoxycarbonyl group indicates that it has protective or modifying characteristics, often utilized in synthetic organic chemistry to enhance stability or solubility. The bicyclic nature of the compound suggests potential applications in medicinal chemistry, as bicyclic structures are common in many biologically active molecules. Additionally, the compound's specific stereochemistry and functional groups may influence its interactions in biological systems, making it a candidate for further research in drug development or as a synthetic intermediate. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in various fields, including pharmaceuticals and materials science.

Formula: C₁₃H₁₉NO₄

InChI: InChI=1S/C13H19NO4/c1-13(2,3)18-12(17)14-10-8-5-4-7(6-8)9(10)11(15)16/h4-5,7-10H,6H2,1-3H3,(H,14,17)(H,15,16)

InChI key: InChIKey=ZPMJBHUNSHDFPT-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1C2CC(C1C(O)=O)C=C2

Synonyms:

• Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-
• 3-[(tert-Butoxycarbonyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
• 3-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid