
CAS 1022968-46-2
:2-(Isopropylsulfonyl)aniline hydrochloride
Description:
2-(Isopropylsulfonyl)aniline hydrochloride is a chemical compound characterized by its sulfonamide functional group, which contributes to its solubility and reactivity. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in diverse applications, including pharmaceuticals and agrochemicals. The presence of the isopropylsulfonyl group enhances its biological activity, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound's molecular structure includes an aniline moiety, which is known for its role in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data sheets should be consulted for handling precautions, as with many sulfonamide derivatives, it may pose risks such as skin irritation or allergic reactions. Overall, 2-(Isopropylsulfonyl)aniline hydrochloride is a versatile compound with significant potential in chemical synthesis and medicinal chemistry.
Formula:C9H14ClNO2S
InChI:InChI=1S/C9H13NO2S.ClH/c1-7(2)13(11,12)9-6-4-3-5-8(9)10;/h3-7H,10H2,1-2H3;1H
InChI key:ZDKZHWSVQDWEDU-UHFFFAOYSA-N
SMILES:CC(C)S(=O)(=O)C1=CC=CC=C1N.Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery