CAS 1022990-86-8

(αS)-α-Amino-3,4,5-trifluorobenzeneacetic acid

Description:

(αS)-α-Amino-3,4,5-trifluorobenzeneacetic acid is an amino acid derivative characterized by the presence of a trifluoromethyl-substituted aromatic ring and an amino group. This compound features a chiral center, which contributes to its stereochemistry, specifically the (αS) configuration. The trifluoromethyl groups enhance its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. The presence of the amino group allows it to participate in various chemical reactions, including peptide bond formation, which is essential in the synthesis of peptides and proteins. Additionally, the trifluorobenzene moiety can impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. As a result, (αS)-α-amino-3,4,5-trifluorobenzeneacetic acid may serve as a valuable building block in medicinal chemistry and drug design, particularly in the development of compounds with specific biological activities. Its solubility, stability, and reactivity are influenced by the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₈H₆F₃NO₂

InChI: InChI=1S/C8H6F3NO2/c9-4-1-3(7(12)8(13)14)2-5(10)6(4)11/h1-2,7H,12H2,(H,13,14)/t7-/m0/s1

InChI key: InChIKey=SKPOIZISALNBFF-ZETCQYMHSA-N

SMILES: [C@H](C(O)=O)(N)C1=CC(F)=C(F)C(F)=C1

Synonyms:

• (2s)-2-Amino-2-(3,4,5-trifluorophenyl)acetic acid
• (S)-2-Amino-2-(3,4,5-trifluorophenyl)acetic acid
• Benzeneacetic acid, α-amino-3,4,5-trifluoro-, (αS)-
• (αS)-α-Amino-3,4,5-trifluorobenzeneacetic acid