CymitQuimica logo

CAS 1023-67-2

:

2-[2-(4-nitrophenyl)ethenyl]pyridine

Description:
2-[2-(4-Nitrophenyl)ethenyl]pyridine, with the CAS number 1023-67-2, is an organic compound characterized by its pyridine ring and a vinyl group substituted with a 4-nitrophenyl moiety. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its electronic properties and reactivity. It is known for its potential applications in organic synthesis, particularly in the development of dyes and pharmaceuticals, owing to its ability to participate in various chemical reactions, such as nucleophilic substitutions and electrophilic additions. The presence of the nitro group enhances its electron-withdrawing characteristics, which can affect the acidity of the hydrogen atoms in the pyridine ring. Additionally, this compound may exhibit fluorescence properties, making it useful in certain analytical applications. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling procedures should be followed.
Formula:C13H10N2O2
InChI:InChI=1/C13H10N2O2/c16-15(17)13-8-5-11(6-9-13)4-7-12-3-1-2-10-14-12/h1-10H
SMILES:c1ccnc(c1)C=Cc1ccc(cc1)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.