
CAS 1023-95-6
:N,N-Bis(trimethylsilyl)benzenesulfonamide
Description:
N,N-Bis(trimethylsilyl)benzenesulfonamide is an organosilicon compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, with two trimethylsilyl groups substituting the nitrogen atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its stability and solubility in organic solvents, making it useful in various chemical applications, including as a reagent in organic synthesis and as a protecting group for amines. The trimethylsilyl groups enhance its hydrophobic properties and can facilitate reactions by stabilizing intermediates. Additionally, it exhibits low volatility and is relatively inert under standard conditions, although it may react with strong nucleophiles or under specific catalytic conditions. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes. Proper storage in a cool, dry place away from moisture is recommended to maintain its integrity.
Formula:C12H23NO2SSi2
InChI:InChI=1S/C12H23NO2SSi2/c1-17(2,3)13(18(4,5)6)16(14,15)12-10-8-7-9-11-12/h7-11H,1-6H3
InChI key:InChIKey=URDZLFIFQKATDZ-UHFFFAOYSA-N
SMILES:S(N([Si](C)(C)C)[Si](C)(C)C)(=O)(=O)C1=CC=CC=C1
Synonyms:- Benzenesulfonamide, N,N-bis(trimethylsilyl)-
- N,N-Bis(trimethylsilyl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
