CAS 10230-76-9

4-[(2,2-Dichloroethyl)sulfonyl]-1-methoxy-2-nitrobenzene

Description:

4-[(2,2-Dichloroethyl)sulfonyl]-1-methoxy-2-nitrobenzene, with the CAS number 10230-76-9, is an organic compound characterized by its complex structure that includes a nitro group, a methoxy group, and a sulfonyl moiety attached to a benzene ring. This compound features a dichloroethyl group, which contributes to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group suggests that it may participate in electrophilic aromatic substitution reactions, while the sulfonyl group can enhance its reactivity towards nucleophiles. Additionally, the dichloroethyl substituent may impart specific biological activities, making this compound of interest in medicinal chemistry and agrochemical research. Safety considerations are important, as the dichloroethyl group can be associated with toxicity, necessitating careful handling and storage. Overall, this compound's unique functional groups and structural features make it a subject of interest in various fields of chemical research.

Formula: C₉H₉Cl₂NO₅S

InChI: InChI=1S/C9H9Cl2NO5S/c1-17-8-3-2-6(4-7(8)12(13)14)18(15,16)5-9(10)11/h2-4,9H,5H2,1H3

InChI key: InChIKey=MVFNAYBRMRRTTO-UHFFFAOYSA-N

SMILES: S(CC(Cl)Cl)(=O)(=O)C1=CC(N(=O)=O)=C(OC)C=C1

Synonyms:

• Benzene, 4-[(2,2-dichloroethyl)sulfonyl]-1-methoxy-2-nitro-
• Anisole, 4-[(2,2-dichloroethyl)sulfonyl]-2-nitro-
• 4-[(2,2-Dichloroethyl)sulfonyl]-1-methoxy-2-nitrobenzene

Benzene, 4-[(2,2-dichloroethyl)sulfonyl]-1-methoxy-2-nitro-

CAS: 10230-76-9

Formula: C₉H₉Cl₂NO₅S

Molecular weight: 314.1425

Ref: IN-DA00075H