CymitQuimica logo

CAS 102306-78-5

:

6,7-dihydrocyclopenta-1,3-dioxin-5(4H)-one

Description:
6,7-Dihydrocyclopenta-1,3-dioxin-5(4H)-one, identified by its CAS number 102306-78-5, is a cyclic organic compound characterized by a five-membered dioxin ring structure. This compound features two oxygen atoms incorporated into the ring, contributing to its unique chemical properties. The presence of a carbonyl group (C=O) enhances its reactivity, making it a potential candidate for various chemical transformations. It is typically colorless to pale yellow and may exhibit a distinct odor. The compound is soluble in organic solvents, which is common for many cyclic ethers and dioxins. Its stability can be influenced by environmental factors such as temperature and light, and it may undergo reactions typical of dioxins, including electrophilic substitution and nucleophilic attack. Due to its structural characteristics, it may also exhibit biological activity, although specific biological effects would depend on the context of its use. As with many chemical substances, safety precautions should be observed when handling it, considering potential toxicity and environmental impact.
Formula:C7H8O3
InChI:InChI=1/C7H8O3/c8-6-1-2-7-5(6)3-9-4-10-7/h1-4H2
SMILES:C1CC2=C(COCO2)C1=O
Synonyms:
  • 6,7-dihydrocyclopenta[d][1,3]dioxin-5(4H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.