
CAS 102308-33-8
:1,3-Butadien-2-ol, 1-methoxy-3-[(trimethylsilyl)oxy]-, 2-acetate, (1Z)-
Description:
1,3-Butadien-2-ol, 1-methoxy-3-[(trimethylsilyl)oxy]-, 2-acetate, (1Z)-, with CAS number 102308-33-8, is an organic compound characterized by its complex structure that includes a butadiene backbone, a methoxy group, and a trimethylsilyl ether functionality. This compound is typically classified as a derivative of butadiene, featuring both alcohol and acetate functional groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical reactions, including those involving nucleophiles. The (1Z)- designation indicates a specific geometric isomerism, which can influence the compound's physical and chemical properties, such as boiling point and reactivity. Overall, this compound is of interest in fields such as medicinal chemistry and materials science, where its unique structural features may be exploited for the development of new materials or pharmaceuticals.
Formula:C10H18O4Si
InChI:InChI=1S/C10H18O4Si/c1-8(14-15(4,5)6)10(7-12-3)13-9(2)11/h7H,1H2,2-6H3/b10-7-
InChI key:InChIKey=ZGXILINNKVAZTI-YFHOEESVSA-N
SMILES:C(\C(O[Si](C)(C)C)=C)(/OC(C)=O)=C/OC
Synonyms:- 1,3-Butadien-2-ol, 1-methoxy-3-[(trimethylsilyl)oxy]-, 2-acetate, (1Z)-
- 1,3-Butadien-2-ol, 1-methoxy-3-[(trimethylsilyl)oxy]-, acetate, (1Z)-
- 1,3-Butadien-2-ol, 1-methoxy-3-[(trimethylsilyl)oxy]-, acetate, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Butadien-2-ol, 1-methoxy-3-[(trimethylsilyl)oxy]-, 2-acetate, (1Z)-
CAS:Formula:C10H18O4SiMolecular weight:230.3330
