CAS 102308-44-1

N-Ethyl-2-piperidineacetamide

Description:

N-Ethyl-2-piperidineacetamide, with the CAS number 102308-44-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethyl group attached to the nitrogen atom of the piperidine, along with an acetamide functional group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of both the piperidine and acetamide functionalities suggests that it may exhibit properties such as solubility in polar solvents and potential hydrogen bonding capabilities. N-Ethyl-2-piperidineacetamide may be of interest in medicinal chemistry due to its structural features, which could influence biological activity. Additionally, its synthesis and reactivity can be explored in various organic reactions, making it a valuable compound in research and development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-2-10-9(12)7-8-5-3-4-6-11-8/h8,11H,2-7H2,1H3,(H,10,12)

InChI key: InChIKey=DXSIWZMPELQDJX-UHFFFAOYSA-N

SMILES: C(C(NCC)=O)C1CCCCN1

Synonyms:

• 2-Piperidineacetamide, N-ethyl-
• N-Ethyl-2-piperidineacetamide
• [2]Piperidyl-acetic acid ethylamide

N-Ethyl-2-(piperidin-2-yl)acetamide

CAS: 102308-44-1

Versatile small molecule scaffold

Formula: C₉H₁₈N₂O

Purity: Min. 95%

Molecular weight: 170.25 g/mol

Ref: 3D-CEA30844