CymitQuimica logo

CAS 102308-82-7

:

N-[2-(3-CHLOROPHENOXY)ETHYL]-N-METHYLAMINE

Description:
N-[2-(3-Chlorophenoxy)ethyl]-N-methylamine is an organic compound characterized by its amine functional group and a chlorophenoxy substituent. It features a nitrogen atom bonded to a methyl group and an ethyl chain that connects to a 3-chlorophenoxy group, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the amine group. The chlorophenoxy moiety can impart biological activity, making this compound of interest in various fields, including pharmaceuticals and agrochemicals. Its structure suggests potential interactions with biological systems, particularly in relation to neurotransmitter pathways or herbicidal activity. As with many amines, it may have basic properties and can participate in various chemical reactions, such as alkylation or acylation. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested.
Formula:C9H12ClNO
InChI:InChI=1/C9H12ClNO/c1-11-5-6-12-9-4-2-3-8(10)7-9/h2-4,7,11H,5-6H2,1H3
InChI key:ZLHBSKXCIBNODG-UHFFFAOYSA-N
SMILES:CNCCOc1cccc(c1)Cl
Synonyms:
  • 2-(3-chlorophenoxy)-N-methylethanaminium
  • 2-(3-chlorophenoxy)-N-methylethanamine
Found 2 products.