CAS 102312-48-1

5-Nitro-3-quinolinecarboxylic acid

Description:

5-Nitro-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a nitro group at the 5-position and a carboxylic acid group at the 3-position contributes to its chemical reactivity and potential applications. This compound typically exhibits properties such as moderate solubility in polar solvents and may show varying solubility in non-polar solvents. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The nitro group can participate in electrophilic substitution reactions, while the carboxylic acid group can engage in acid-base reactions. Additionally, 5-nitro-3-quinolinecarboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock. Overall, this compound is significant in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₆N₂O₄

InChI: InChI=1S/C10H6N2O4/c13-10(14)6-4-7-8(11-5-6)2-1-3-9(7)12(15)16/h1-5H,(H,13,14)

InChI key: InChIKey=NRLLDCUNEXQZDW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C2=C(N=CC(C(O)=O)=C2)C=CC1

Synonyms:

• 5-Nitro-3-quinolinecarboxylic acid
• 3-Quinolinecarboxylic acid, 5-nitro-
• NSC 136920