CymitQuimica logo

CAS 102319-76-6

:

4,4'-[propane-1,3-diylbis(oxy)]bis(N,N-dimethylaniline)

Description:
4,4'-[Propane-1,3-diylbis(oxy)]bis(N,N-dimethylaniline), identified by its CAS number 102319-76-6, is an organic compound characterized by its structure, which features two N,N-dimethylaniline groups connected by a propane-1,3-diyl bis(oxy) linker. This compound typically exhibits properties associated with both amine and ether functionalities, which can influence its solubility, reactivity, and potential applications. It is likely to be a viscous liquid or solid at room temperature, depending on its molecular weight and intermolecular interactions. The presence of dimethylamino groups suggests potential basicity and nucleophilicity, making it reactive in various chemical environments. Additionally, the ether linkages may contribute to its stability and solubility in organic solvents. This compound may find applications in fields such as materials science, particularly in the development of polymers or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity associated with amine derivatives.
Formula:C19H26N2O2
InChI:InChI=1/C19H26N2O2/c1-20(2)16-6-10-18(11-7-16)22-14-5-15-23-19-12-8-17(9-13-19)21(3)4/h6-13H,5,14-15H2,1-4H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.