CAS 102321-36-8
:4-{[5-(4-ethoxyphenoxy)pentyl]oxy}aniline
Description:
4-{[5-(4-ethoxyphenoxy)pentyl]oxy}aniline, with the CAS number 102321-36-8, is an organic compound characterized by its complex molecular structure, which includes an aniline group and ether linkages. This compound features a phenoxy group substituted with an ethoxy moiety, contributing to its hydrophobic characteristics. The presence of the pentyl chain enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and materials science. The aniline portion of the molecule provides potential for reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit interesting thermal and optical properties due to its aromatic components. Its specific applications can vary, but it may be utilized in the development of dyes, pharmaceuticals, or as a building block in polymer chemistry. Safety and handling considerations should be taken into account, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C19H25NO3
InChI:InChI=1/C19H25NO3/c1-2-21-17-10-12-19(13-11-17)23-15-5-3-4-14-22-18-8-6-16(20)7-9-18/h6-13H,2-5,14-15,20H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aniline, p-(5-(p-ethoxyphenoxy)pentyloxy)-
CAS:Aniline, p-(5-(p-ethoxyphenoxy)pentyloxy)- is a bioactive chemical.Formula:C19H25NO3Color and Shape:SolidMolecular weight:315.41
