
CAS 1023299-00-4
:1,1-Dimethylethyl N-[1-(3-amino-4-pyridinyl)-4-piperidinyl]carbamate
Description:
1,1-Dimethylethyl N-[1-(3-amino-4-pyridinyl)-4-piperidinyl]carbamate, identified by its CAS number 1023299-00-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a pyridine ring, and a piperidine moiety, which contribute to its biological activity. Typically, carbamates are known for their potential applications in pharmaceuticals, particularly as enzyme inhibitors or in the development of therapeutic agents. The presence of the amino and piperidinyl groups suggests that this compound may interact with biological targets, potentially influencing neurotransmitter systems or other physiological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C15H24N4O2
InChI:InChI=1S/C15H24N4O2/c1-15(2,3)21-14(20)18-11-5-8-19(9-6-11)13-4-7-17-10-12(13)16/h4,7,10-11H,5-6,8-9,16H2,1-3H3,(H,18,20)
InChI key:InChIKey=PCNWTXFOPNURHW-UHFFFAOYSA-N
SMILES:NC=1C(=CC=NC1)N2CCC(NC(OC(C)(C)C)=O)CC2
Synonyms:- Carbamic acid, N-[1-(3-amino-4-pyridinyl)-4-piperidinyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[1-(3-amino-4-pyridinyl)-4-piperidinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.