CAS 10233-14-4

9-Octadecenoic acid (9Z)-, 2-[2-(2-hydroxyethoxy)ethoxy]ethyl ester

Description:

9-Octadecenoic acid (9Z)-, 2-[2-(2-hydroxyethoxy)ethoxy]ethyl ester, commonly known as oleic acid ethoxylate, is an ester derived from oleic acid and a polyethylene glycol ether. This compound typically exhibits characteristics such as being a viscous liquid at room temperature, with a hydrophilic head due to the ethoxy groups and a hydrophobic tail from the long-chain fatty acid. It is generally soluble in organic solvents and has limited solubility in water, making it useful as a surfactant and emulsifier in various applications, including cosmetics, pharmaceuticals, and food products. The presence of the ethoxy groups enhances its surfactant properties, allowing it to reduce surface tension and stabilize emulsions. Additionally, this compound may exhibit low toxicity and biodegradability, making it an environmentally friendly option in formulations. Its chemical structure contributes to its ability to interact with both polar and non-polar substances, which is essential for its function in various industrial and consumer applications.

Formula: C₂₄H₄₆O₅

InChI: InChI=1S/C24H46O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(26)29-23-22-28-21-20-27-19-18-25/h9-10,25H,2-8,11-23H2,1H3/b10-9-

InChI key: InChIKey=RMLRKDHXZUVGCH-KTKRTIGZSA-N

SMILES: C(C(OCCOCCOCCO)=O)CCCCCC/C=C\CCCCCCCC

Synonyms:

• 9-Octadecenoic acid (9Z)-, 2-[2-(2-hydroxyethoxy)ethoxy]ethyl ester
• Motricol
• Oleic acid, 2-[2-(2-hydroxyethoxy)ethoxy]ethyl ester
• Triethylene glycol, monooleate
• 9-Octadecenoic acid (Z)-, 2-[2-(2-hydroxyethoxy)ethoxy]ethyl ester

2-[2-(2-hydroxyethoxy)ethoxy]ethyl oleate

CAS: 10233-14-4

Formula: C₂₄H₄₆O₅

Molecular weight: 414.6190

Ref: IN-DA009QB2