CAS 102336-08-3

Methyl 2-methoxy-4-pyridinepropanoate

Description:

Methyl 2-methoxy-4-pyridinepropanoate, with the CAS number 102336-08-3, is an organic compound characterized by its pyridine ring and ester functional group. This substance features a methoxy group attached to the pyridine, which contributes to its polar nature and potential solubility in polar solvents. The presence of the propanoate moiety indicates that it is an ester, which typically exhibits moderate volatility and can participate in various chemical reactions, such as hydrolysis and transesterification. Methyl 2-methoxy-4-pyridinepropanoate may be utilized in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential biological activity, which could be explored in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy and pyridine groups, making it a subject of interest in both synthetic and applied chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₁₃NO₃

InChI: InChI=1S/C10H13NO3/c1-13-9-7-8(5-6-11-9)3-4-10(12)14-2/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=FYTWXMZUVFYMNA-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)C=1C=C(OC)N=CC1

Synonyms:

• 4-Pyridinepropanoic acid, 2-methoxy-, methyl ester
• Methyl 2-methoxy-4-pyridinepropanoate