CAS 102338-87-4
:4-Chloro-3,5-dihydroxybenzoic acid
Description:
4-Chloro-3,5-dihydroxybenzoic acid is an aromatic compound characterized by the presence of a chloro group and two hydroxyl groups attached to a benzoic acid framework. Its molecular structure features a benzene ring with a carboxylic acid functional group, which contributes to its acidity and potential for hydrogen bonding. The chloro substituent introduces electronegativity, influencing the compound's reactivity and solubility in various solvents. The hydroxyl groups enhance its polarity, making it more soluble in polar solvents like water. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Additionally, its structural features suggest it could participate in various chemical reactions, such as esterification or nucleophilic substitution. The presence of multiple functional groups allows for diverse applications in organic synthesis and materials science. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are important in its handling and use.
Formula:C7H5ClO4
InChI:InChI=1/C7H5ClO4/c8-6-4(9)1-3(7(11)12)2-5(6)10/h1-2,9-10H,(H,11,12)
SMILES:c1c(cc(c(c1O)Cl)O)C(=O)O
Synonyms:- alpha-Resorcylic acid, 4-chloro-
- p-Chloro-3,5-dihydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Chloro-3,5-dihydroxybenzoic acid
CAS:<p>4-Chloro-3,5-dihydroxybenzoic acid is a chemical substance that can be used as a building block in organic synthesis. It is also a versatile intermediate and scaffold for the synthesis of more complex compounds. 4-Chloro-3,5-dihydroxybenzoic acid has been found to be useful in research and as a reagent because it is an inexpensive, high quality chemical. This compound reacts rapidly with many other chemicals, including alcohols and amines. 4-Chloro-3,5-dihydroxybenzoic acid has been shown to be stable under acidic conditions and can be purified by crystallization or recrystallization.</p>Formula:C7H5ClO4Purity:Min. 95%Color and Shape:PowderMolecular weight:188.56 g/mol
